
Chemical formula: CH3(CH2)10CH2(OCH2CH2)nOSO3Na
Synonyms: sodium laureth sulfate, SLES 70%
Packing: Barrels 170 kg
Manufacturer: China
Price: from 1.65 dollar/kilogram
Viscous liquid of colorless or yellowish color, practically odorless.
Store in a plastic, or plastic-braided, or steel, tightly closed container in a temperature range from 5 to 40℃, do not store near strong oxidizing agents that can provoke a fire hazard.